CAS 87498-62-2
:N-(1-methyl-2-phenylethyl)morpholin-4-amine
Description:
N-(1-methyl-2-phenylethyl)morpholin-4-amine, with the CAS number 87498-62-2, is a chemical compound characterized by its morpholine structure, which includes a morpholine ring substituted with an amine group and a phenylethyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the phenyl group contributes to its hydrophobic characteristics, while the morpholine ring adds to its potential for forming interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific biological activities. Additionally, its synthesis and reactivity can be influenced by the functional groups present, making it a candidate for further exploration in drug development or as a chemical intermediate. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C13H20N2O
InChI:InChI=1/C13H20N2O/c1-12(11-13-5-3-2-4-6-13)14-15-7-9-16-10-8-15/h2-6,12,14H,7-11H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
