CymitQuimica logo

CAS 87498-71-3

:

2-chloro-2-fluorooxirane

Description:
2-Chloro-2-fluorooxirane, also known as a halogenated epoxide, is a chemical compound characterized by the presence of both chlorine and fluorine substituents on a three-membered cyclic ether structure known as an oxirane. This compound typically exhibits a high degree of reactivity due to the strained nature of the epoxide ring, making it susceptible to nucleophilic attack. The presence of the electronegative chlorine and fluorine atoms can influence its chemical behavior, including its reactivity and polarity. 2-Chloro-2-fluorooxirane is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its physical properties, such as boiling point and solubility, can vary depending on the specific conditions and the presence of other functional groups. Safety considerations are important when handling this compound, as halogenated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.
Formula:C2H2ClFO
InChI:InChI=1/C2H2ClFO/c3-2(4)1-5-2/h1H2
Synonyms:
  • Oxirane, chlorofluoro-
  • Chlorofluorooxirane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.