CAS 874990-50-8

(3R,4S)-1-benzyl-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid

Description:

The chemical substance known as (3R,4S)-1-benzyl-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid, with the CAS number 874990-50-8, is a chiral compound featuring a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound exhibits specific stereochemistry, indicated by the (3R,4S) configuration, which influences its biological activity and interactions. The presence of a benzyl group and a 2-fluorophenyl substituent contributes to its lipophilicity and potential for binding to various biological targets. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine atom in the 2-fluorophenyl group can enhance the compound's metabolic stability and influence its pharmacokinetic properties. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes due to its unique structural features.

Formula: C₁₈H₁₈FNO₂

InChI: InChI=1/C18H18FNO2/c19-17-9-5-4-8-14(17)15-11-20(12-16(15)18(21)22)10-13-6-2-1-3-7-13/h1-9,15-16H,10-12H2,(H,21,22)/t15-,16+/m1/s1