CAS 875-60-5

6-Amino-1,2-dihydro-2-thioxo-5-pyrimidinecarboxylic acid

Description:

6-Amino-1,2-dihydro-2-thioxo-5-pyrimidinecarboxylic acid, also known by its CAS number 875-60-5, is a heterocyclic compound featuring a pyrimidine ring. This substance is characterized by the presence of an amino group and a thioxo group, which contribute to its reactivity and potential biological activity. It typically appears as a crystalline solid and is soluble in polar solvents, reflecting its polar functional groups. The compound is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. Its structure allows for hydrogen bonding and interactions with biological targets, making it a candidate for further research in drug development. Additionally, the thioxo group may impart unique properties that could enhance its efficacy or selectivity in biological systems. Overall, 6-Amino-1,2-dihydro-2-thioxo-5-pyrimidinecarboxylic acid represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₅H₅N₃O₂S

InChI: InChI=1S/C5H5N3O2S/c6-3-2(4(9)10)1-7-5(11)8-3/h1H,(H,9,10)(H3,6,7,8,11)

InChI key: InChIKey=DRCCUWZDHQOJQA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)NC(=S)N=C1

Synonyms:

• 6-Amino-1,2-dihydro-2-thioxo-5-pyrimidinecarboxylic acid
• 5-Pyrimidinecarboxylic acid, 4-amino-2-mercapto-
• 5-Pyrimidinecarboxylic acid, 6-amino-1,2-dihydro-2-thioxo-
• 4-Amino-2-mercaptopyrimidine-5-carboxylic acid
• Pyrimidine-5-carboxylic acid, 4-amino-2-mercapto-
• 4-amino-2-sulfanylidene-3H-pyrimidine-5-carboxylic acid
• 4-amino-2-thioxo-3H-pyrimidine-5-carboxylic acid
• 6-Amino-2-thioxo-1,2-dihydropyrimidine-5-carboxylic acid