CAS 875057-34-4

Glycine, N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(carboxymethyl)-

Description:

Glycine, N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(carboxymethyl)-, commonly referred to as a derivative of glycine, is an amino acid-based compound characterized by its unique structure that includes both amino and carboxymethyl functional groups. This compound features a branched ethoxy chain, which enhances its solubility and potential biological activity. It is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. The presence of amino groups suggests that it may participate in various biochemical reactions, potentially acting as a ligand or a building block in peptide synthesis. Its applications may extend to pharmaceuticals, biochemistry, and materials science, where it could serve as a stabilizing agent or a component in drug formulations. As with many amino acid derivatives, it may exhibit properties such as low toxicity and biocompatibility, making it suitable for various biological applications. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₀H₂₀N₂O₆

InChI: InChI=1S/C10H20N2O6/c11-1-3-17-5-6-18-4-2-12(7-9(13)14)8-10(15)16/h1-8,11H2,(H,13,14)(H,15,16)

InChI key: IJHPDWGJSZIAEX-UHFFFAOYSA-N

SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N