CAS 875063-84-6

L-Proline, L-tyrosyl-L-cysteinyl-L-arginyl-

Description:

L-Proline, L-tyrosyl-L-cysteinyl-L-arginyl- is a peptide that consists of multiple amino acids, specifically proline, tyrosine, cysteine, and arginine. This compound is characterized by its structure, which includes a sequence of these amino acids linked by peptide bonds. The presence of proline contributes to the stability of the peptide's structure due to its unique cyclic structure, while tyrosine provides aromatic properties and potential sites for phosphorylation. Cysteine introduces the ability to form disulfide bonds, which can further stabilize the peptide's conformation. Arginine, with its positively charged side chain, plays a crucial role in interactions with other biomolecules. This peptide may exhibit biological activities, including roles in signaling pathways or as a building block for larger proteins. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound is of interest in biochemical research and potential therapeutic applications due to its diverse amino acid composition.

Formula: C₂₃H₃₅N₇O₆S

InChI: InChI=1S/C23H35N7O6S/c24-15(11-13-5-7-14(31)8-6-13)19(32)29-17(12-37)20(33)28-16(3-1-9-27-23(25)26)21(34)30-10-2-4-18(30)22(35)36/h5-8,15-18,31,37H,1-4,9-12,24H2,(H,28,33)(H,29,32)(H,35,36)(H4,25,26,27)/t15-,16-,17-,18-/m0/s1

InChI key: UEIYSERYALALSK-XSLAGTTESA-N

SMILES: C1C[C@H](N(C1)C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CS)NC(=O)[C@H](CC2=CC=C(C=C2)O)N)C(=O)O