CAS 87508-17-6: (4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Description:The chemical substance with the name "(4aR,6S,7R,8R,8aS)-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol" and CAS number "87508-17-6" is a complex organic compound characterized by its unique stereochemistry and functional groups. It features a hexahydropyrano structure, which is a bicyclic system containing both a pyran and dioxine moiety, contributing to its potential reactivity and biological activity. The presence of phenyl and phenylsulfanyl groups suggests that the compound may exhibit interesting electronic properties and could participate in various chemical reactions, including electrophilic substitutions. The specific stereochemistry indicated by the (R) and (S) designations implies that the compound may have distinct spatial arrangements that could influence its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the hydroxyl groups (diol) present in the structure may enhance solubility and reactivity, potentially leading to applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.
Formula:C19H20O5S
InChI:InChI=1/C19H20O5S/c20-15-16(21)19(25-13-9-5-2-6-10-13)23-14-11-22-18(24-17(14)15)12-7-3-1-4-8-12/h1-10,14-21H,11H2/t14-,15-,16-,17-,18?,19+/m1/s1
- Synonyms:
- Phenyl 4,6-O-Benzylidene-1-thio-β-D-glucopyranoside
- β-D-glucopyranoside, phenyl 4,6-O-(phenylmethylene)-1-thio-Phenyl 4,6-o-benzylidene-1-thio-beta-D-glucopyranoside
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Phenyl 4,6-O-Benzylidene-1-thio-β-D-glucopyranoside REF: 3B-P1475CAS: 87508-17-6 | >98.0%(HPLC) | 287.00 € | Tue 22 Apr 25 |
![]() | PHENYL 4,6-O-BENZYLIDENE-1-THIO-β-D-GLUCOPYRANOSIDE REF: IN-DA003TOSCAS: 87508-17-6 | 98% | 122.00 €~248.00 € | Tue 29 Apr 25 |

Phenyl 4,6-O-Benzylidene-1-thio-β-D-glucopyranoside
Ref: 3B-P1475
5g | 287.00 € |

PHENYL 4,6-O-BENZYLIDENE-1-THIO-β-D-GLUCOPYRANOSIDE
Ref: IN-DA003TOS
1g | 122.00 € | ||
5g | 248.00 € |