CAS 87508-18-7

Phenyl 4,6-O-benzylidene-1-thio-β-D-galactopyranoside

Description:

Phenyl 4,6-O-benzylidene-1-thio-β-D-galactopyranoside is a glycoside derivative characterized by its unique structural features, which include a galactopyranoside backbone modified with a thioether group and a benzylidene moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as methanol and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic benzylidene substituent. The thioether linkage contributes to its chemical stability and may influence its reactivity in various chemical reactions. Additionally, this compound can be of interest in biochemical applications, particularly in studies related to carbohydrate chemistry and enzyme interactions, as it may serve as a substrate or inhibitor for specific glycosidases. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the design of compounds with biological activity. As with many glycosides, it may exhibit specific optical activity, which can be analyzed using polarimetry.

Formula: C₁₉H₂₀O₅S

InChI: InChI=1S/C19H20O5S/c20-15-16(21)19(25-13-9-5-2-6-10-13)23-14-11-22-18(24-17(14)15)12-7-3-1-4-8-12/h1-10,14-21H,11H2/t14-,15-,16-,17+,18+,19+/m1/s1

InChI key: InChIKey=BDNIQCYVYFGHSI-VWQYPGANSA-N

SMILES: O[C@H]1[C@@]2([C@](O[C@@H](SC3=CC=CC=C3)[C@@H]1O)(CO[C@@H](O2)C4=CC=CC=C4)[H])[H]

Synonyms:

• β-D-Glucopyranoside, phenyl 4,6-O-(phenylmethylene)-1-thio-, (S)-
• Phenyl 4,6-O-benzylidene-1-thio-β-D-galactopyranoside
• Phenyl 4,6-O-[(S)-phenylmethylene]-1-thio-β-D-galactopyranoside
• Pyrano[3,2-d]-1,3-dioxin, β-D-glucopyranoside deriv.
• β-D-Galactopyranoside, phenyl 4,6-O-[(S)-phenylmethylene]-1-thio-