CAS 87512-31-0
:Fmoc-Ala-Ala-OH
Description:
Fmoc-Ala-Ala-OH, also known as Fmoc-dialanine, is a protected amino acid derivative commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective moiety for the amino group, allowing for selective reactions during the synthesis process. This compound features two alanine residues, which are non-polar, aliphatic amino acids, contributing to its hydrophobic characteristics. Fmoc-Ala-Ala-OH is typically utilized in solid-phase peptide synthesis, where the Fmoc group can be easily removed under basic conditions, facilitating the sequential addition of other amino acids. The compound is generally stable under standard laboratory conditions but should be handled with care to avoid moisture and light exposure, which can lead to degradation. Its solubility is typically in organic solvents, making it suitable for various synthetic applications. Overall, Fmoc-Ala-Ala-OH is a valuable building block in the field of peptide chemistry, aiding in the construction of more complex peptide structures for research and therapeutic purposes.
Formula:C21H22N2O5
InChI:InChI=1S/C21H22N2O5/c1-12(19(24)22-13(2)20(25)26)23-21(27)28-11-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,12-13,18H,11H2,1-2H3,(H,22,24)(H,23,27)(H,25,26)/t12-,13-/m0/s1
InChI key:VXGGBPQPMISJCA-STQMWFEESA-N
SMILES:C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Fmoc-Ala-Ala-OH
CAS:Kang et al. coupled this Fmoc-dipeptide to H-Hyp-Wang resin to avoid diketopiperazine formation. Forms hydrogels at acidic pH.Formula:C21H22N2O5Purity:99.33%Color and Shape:WhiteMolecular weight:382.42Fmoc-Ala-Ala-OH
CAS:Formula:C21H22N2O5Purity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:382.41Fmoc-Ala-Ala-OH
CAS:Fmoc-Ala-Ala-OHFormula:C21H22N2O5Purity:97%Color and Shape:SolidMolecular weight:382.40977Ref: IN-DA004FK1
250mg20.00€1g24.00€5g47.00€10g65.00€25g121.00€50g179.00€100g279.00€250g530.00€500g852.00€1kg886.00€5kg4,437.00€10kg8,451.00€Fmoc-Ala-Ala-OH
CAS:Fmoc-Ala-Ala-OH is a synthetic amino acid that is used in organic synthesis. It has been used to prepare cyclic peptides with lysine residues for the treatment of inflammatory diseases. Fmoc-Ala-Ala-OH is soluble in acidic environments and can be synthesized at reaction temperatures below 0 ˚C, making it suitable for solid-phase synthesis. In biological studies, Fmoc-Ala-Ala-OH has been shown to have anticancer effects against human cancer cells by causing frameshifting and inhibiting protein synthesis. Fmoc-Ala-Ala-OH also binds to disulfide bonds between cysteine residues in proteins, which may account for its antimicrobial properties.Formula:C21H22N2O5Purity:Min. 95%Color and Shape:solid.Molecular weight:382.41 g/mol






