CAS 875126-51-5

4-(1-Piperidinylmethyl)benzenemethanamine dihydrochloride

Description:

4-(1-Piperidinylmethyl)benzenemethanamine dihydrochloride, identified by its CAS number 875126-51-5, is a chemical compound characterized by its piperidine and benzylamine functional groups. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. The compound is often studied for its potential pharmacological properties, particularly in the context of neuroscience and medicinal chemistry, where it may interact with various neurotransmitter systems. Its structure suggests it could act as a ligand for certain receptors, making it of interest in drug development. As with many amines, it may exhibit basic properties, and its behavior in biological systems can be influenced by factors such as pH and the presence of other ions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₂₂Cl₂N₂

InChI: InChI=1/C13H20N2.2ClH/c14-10-12-4-6-13(7-5-12)11-15-8-2-1-3-9-15;;/h4-7H,1-3,8-11,14H2;2*1H

SMILES: C1CCN(CC1)Cc1ccc(cc1)CN.Cl.Cl

Synonyms:

• 4-(1-Piperidinylmethyl)-Benzenemethanaminedi hydrochloride