CymitQuimica logo

CAS 875159-76-5

:

2-(3,5-dimethylphenoxy)-N-methylethanamine

Description:
2-(3,5-Dimethylphenoxy)-N-methylethanamine is an organic compound characterized by its amine functional group and ether linkage. It features a dimethyl-substituted phenyl ring, which contributes to its hydrophobic properties, while the N-methyl and ethylamine components enhance its solubility in polar solvents. The presence of the ether group (phenoxy) suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. This compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its molecular structure indicates that it could participate in hydrogen bonding and hydrophobic interactions, making it relevant in medicinal chemistry and drug design. Additionally, the presence of multiple methyl groups can affect its steric properties and overall stability. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-9-6-10(2)8-11(7-9)13-5-4-12-3/h6-8,12H,4-5H2,1-3H3
InChI key:RLZQQSQHDIDQOD-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(c1)OCCNC
Found 3 products.