CAS 875166-88-4

5-(2,5-Dichlorophenyl)-2-pyridinamine

Description:

5-(2,5-Dichlorophenyl)-2-pyridinamine, identified by its CAS number 875166-88-4, is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with an amine group and a dichlorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amine functional group. The dichlorophenyl substituent can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of chlorine atoms may impart specific characteristics such as increased lipophilicity and potential biological activity. Compounds of this nature are often studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 5-(2,5-Dichlorophenyl)-2-pyridinamine represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₁₁H₈Cl₂N₂

InChI: InChI=1S/C11H8Cl2N2/c12-8-2-3-10(13)9(5-8)7-1-4-11(14)15-6-7/h1-6H,(H2,14,15)

InChI key: InChIKey=LUEAHRGWNYIYHV-UHFFFAOYSA-N

SMILES: ClC1=C(C=C(Cl)C=C1)C=2C=CC(N)=NC2

Synonyms:

• 5-(2,5-Dichlorophenyl)-2-pyridinamine
• 2-Pyridinamine, 5-(2,5-dichlorophenyl)-