CAS 875166-91-9
:5-(2,3-difluorophenyl)pyridin-2-amine
Description:
5-(2,3-Difluorophenyl)pyridin-2-amine, with the CAS number 875166-91-9, is an organic compound characterized by its pyridine and aniline functional groups. This compound features a pyridine ring substituted at the 2-position with an amino group and a phenyl group that is further substituted with two fluorine atoms at the 2 and 3 positions. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's properties, such as solubility, melting point, and reactivity, can be influenced by the electron-withdrawing nature of the fluorine substituents. Overall, 5-(2,3-difluorophenyl)pyridin-2-amine represents a class of compounds that may exhibit unique chemical behavior and biological activity due to its specific structural features.
Formula:C11H8F2N2
InChI:InChI=1/C11H8F2N2/c12-9-3-1-2-8(11(9)13)7-4-5-10(14)15-6-7/h1-6H,(H2,14,15)
SMILES:c1cc(c2ccc(=N)[nH]c2)c(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
