CAS 87517-97-3
:1-methyl-9-nitrophenanthrene
Description:
1-Methyl-9-nitrophenanthrene is an organic compound characterized by its polycyclic aromatic structure, which consists of a phenanthrene backbone with a methyl group and a nitro group substituent. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. This compound typically exhibits a solid state at room temperature and may have a characteristic color, often associated with nitro-substituted aromatic compounds. Its solubility is generally limited in water but may be more soluble in organic solvents such as dichloromethane or acetone. 1-Methyl-9-nitrophenanthrene can be used in research related to organic electronics, photochemistry, and as a precursor in the synthesis of other complex organic molecules. Additionally, due to the presence of the nitro group, it may exhibit some degree of toxicity and environmental persistence, necessitating careful handling and disposal in laboratory settings.
Formula:C15H11NO2
InChI:InChI=1/C15H11NO2/c1-10-5-4-8-12-11-6-2-3-7-13(11)15(16(17)18)9-14(10)12/h2-9H,1H3
Synonyms:- Phenanthrene, 1-methyl-9-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
