CAS 87518-81-8

2-Hexenoic acid, 5-[(phenylmethoxy)methoxy]-, methyl ester, (E)-

Description:

2-Hexenoic acid, 5-[(phenylmethoxy)methoxy]-, methyl ester, (E)- is an organic compound characterized by its unsaturated fatty acid structure, featuring a double bond in the hexenoic acid chain. The presence of the methyl ester functional group indicates that it is a methyl ester derivative, which typically enhances its solubility in organic solvents and may influence its reactivity. The compound also contains a phenylmethoxy substituent, which contributes to its aromatic characteristics and may affect its physical properties, such as boiling point and solubility. The (E)- configuration denotes that the substituents around the double bond are on opposite sides, which can influence the compound's geometry and potential interactions with biological systems. This compound may exhibit properties typical of both fatty acids and esters, including potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₅H₂₀O₄

InChI: InChI=1S/C15H20O4/c1-13(7-6-10-15(16)17-2)19-12-18-11-14-8-4-3-5-9-14/h3-6,8-10,13H,7,11-12H2,1-2H3/b10-6+

InChI key: KZZBGXDTWRWKID-UXBLZVDNSA-N

SMILES: CC(C/C=C/C(=O)OC)OCOCC1=CC=CC=C1