CAS 875256-56-7
:5-(3-Chlorophenyl)dihydro-2(3H)-furanone
Description:
5-(3-Chlorophenyl)dihydro-2(3H)-furanone is an organic compound characterized by its unique structure, which includes a furanone ring fused with a chlorophenyl group. This compound typically exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, and chlorine atoms. The presence of the chlorophenyl moiety suggests potential applications in pharmaceuticals or agrochemicals, as halogenated aromatic compounds often exhibit significant biological activity. The furanone structure contributes to its reactivity, particularly in electrophilic substitution reactions. Additionally, the compound may display specific physical properties such as solubility in organic solvents and a distinct melting or boiling point, influenced by its molecular interactions. Its synthesis may involve various organic reactions, including cyclization and substitution processes. Overall, 5-(3-Chlorophenyl)dihydro-2(3H)-furanone is of interest in chemical research due to its potential applications and the intriguing chemistry associated with its functional groups.
Formula:C10H9ClO2
InChI:InChI=1S/C10H9ClO2/c11-8-3-1-2-7(6-8)9-4-5-10(12)13-9/h1-3,6,9H,4-5H2
InChI key:InChIKey=BXCLFOKTWQYCRY-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C2CCC(=O)O2
Synonyms:- Butyric acid, 4-(m-chlorophenyl)-4-hydroxy-, γ-lactone
- 5-(3-Chlorophenyl)dihydro-2(3H)-furanone
- 2(3H)-Furanone, 5-(3-chlorophenyl)dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.