
CAS 875258-85-8
:Yil 781
Description:
Yil 781, with the CAS number 875258-85-8, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. While specific characteristics such as its molecular structure, physical properties, and biological activity may vary, compounds like Yil 781 are often evaluated for their potential therapeutic applications. Typically, such substances may exhibit properties such as solubility in organic solvents, stability under specific conditions, and reactivity with various functional groups. Additionally, they may be studied for their interactions with biological targets, which can include enzymes or receptors, contributing to their efficacy in treating certain diseases. Safety profiles, including toxicity and environmental impact, are also crucial aspects of their characterization. For detailed information, including specific chemical properties and applications, consulting scientific literature or databases is recommended, as these resources provide comprehensive data on the compound's behavior and uses in research and industry.
Formula:C24H28FN3O2.HCl
InChI:InChI=1S/C24H28FN3O2.ClH/c1-16(2)27-12-4-5-18(14-27)15-28-17(3)26-23-11-10-21(13-22(23)24(28)29)30-20-8-6-19(25)7-9-20;/h6-11,13,16,18H,4-5,12,14-15H2,1-3H3;1H/t18-;/m0./s1
SMILES:CC(C)N1CCC[C@@H](C1)Cn1c(C)nc2ccc(cc2c1=O)Oc1ccc(cc1)F.Cl
Synonyms:- 6-(4-fluorophenoxy)-3-[[(3S)-1-isopropyl-3-piperidyl]methyl]-2-methyl-quinazolin-4-one hydrochloride
- Yil781
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
YIL-781 hydrochloride
CAS:YIL-781 hydrochloride is a type of mitochondrial uncoupler, which prevents ATP synthesis and restores the mitochondrial membrane potential in cells. YIL-781 hydrochloride has been shown to reverse the impaired mitochondrial functions observed in diabetic neuropathy. This drug also activates dopamine and phenylpropionic acid metabolism in wild-type mice, but not in animals with a genetic ablation of dopamine receptors. YIL-781 hydrochloride also has antidiabetic effects when administered orally to rats with experimental diabetes mellitus.Formula:C24H28FN3O2·xHClPurity:Min. 95%Molecular weight:409.5 g/molYIL 781
CAS:YIL 781 is a selective ghrelin receptor antagonist (GHS-R1a) (Ki = 17 nM), showing a weak affinity for kinesin receptors (K = 6 μM).Formula:C24H28FN3O2Purity:98.8%Color and Shape:SolidMolecular weight:409.5




