CAS 87527-43-3

1,3,4-Thiadiazol-2-amine, 5-[(4-chlorophenoxy)methyl]-N-methyl-

Description:

1,3,4-Thiadiazol-2-amine, 5-[(4-chlorophenoxy)methyl]-N-methyl- is a chemical compound characterized by its thiadiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of the amine group contributes to its potential as a base, while the N-methyl substitution enhances its lipophilicity and may influence its biological activity. The 4-chlorophenoxy group attached via a methylene bridge provides additional functional properties, potentially enhancing its solubility and reactivity. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with many heterocyclic compounds, the specific interactions and reactivity can be influenced by the electronic and steric effects of the substituents present. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₀H₁₀ClN₃OS

InChI: InChI=1S/C10H10ClN3OS/c1-12-10-14-13-9(16-10)6-15-8-4-2-7(11)3-5-8/h2-5H,6H2,1H3,(H,12,14)

InChI key: YNFBYZYUGWEURO-UHFFFAOYSA-N

SMILES: CNC1=NN=C(S1)COC2=CC=C(C=C2)Cl