CAS 87527-67-1

1,3,4-Thiadiazol-2-amine, 5-[3-(4-methoxyphenoxy)propyl]-N-methyl-

Description:

1,3,4-Thiadiazol-2-amine, 5-[3-(4-methoxyphenoxy)propyl]-N-methyl- is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound also features a methoxyphenoxy propyl side chain, which may enhance its solubility and interaction with biological targets. Its molecular structure suggests that it could exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. The compound's CAS number, 87527-67-1, allows for easy identification in chemical databases. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and drug development.

Formula: C₁₃H₁₇N₃O₂S

InChI: InChI=1S/C13H17N3O2S/c1-14-13-16-15-12(19-13)4-3-9-18-11-7-5-10(17-2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H,14,16)

InChI key: SIYSNDFVNSSKLJ-UHFFFAOYSA-N

SMILES: CNC1=NN=C(S1)CCCOC2=CC=C(C=C2)OC