CAS 87530-59-4

Bicyclo[3.2.0]hept-6-en-2-one, 7-(diethylamino)-1,6-dimethyl-

Description:

Bicyclo[3.2.0]hept-6-en-2-one, 7-(diethylamino)-1,6-dimethyl- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring with a ketone functional group and a double bond. The presence of the diethylamino group indicates that it has basic properties, which can influence its reactivity and solubility in various solvents. The dimethyl substitutions at positions 1 and 6 contribute to the compound's steric and electronic properties, potentially affecting its stability and reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, which can be explored in drug design and synthesis. Additionally, the compound's CAS number, 87530-59-4, serves as a unique identifier for regulatory and safety information, facilitating its study and application in various chemical contexts.

Formula: C₁₃H₂₁NO

InChI: InChI=1S/C13H21NO/c1-5-14(6-2)12-9(3)10-7-8-11(15)13(10,12)4/h10H,5-8H2,1-4H3

InChI key: AYAJOISXYRZNFF-UHFFFAOYSA-N

SMILES: CCN(CC)C1=C(C2C1(C(=O)CC2)C)C