CAS 87531-10-0

Uridine, 5-[(1E)-2-bromoethenyl]-2′-deoxy-, 3′,5′-bis(4-chlorobenzoate)

Description:

Uridine, 5-[(1E)-2-bromoethenyl]-2′-deoxy-, 3′,5′-bis(4-chlorobenzoate) is a synthetic nucleoside derivative characterized by the presence of a uridine backbone modified with a bromoethenyl group at the 5-position and two 4-chlorobenzoate ester groups at the 3′ and 5′ positions. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of antiviral agents or as a biochemical probe due to its structural similarity to natural nucleosides. The presence of the bromoethenyl moiety may enhance its reactivity and interaction with biological targets, while the chlorobenzoate groups can influence solubility and bioavailability. The compound's molecular structure contributes to its unique chemical properties, including its stability and potential for selective binding to nucleic acid structures. As with many nucleoside analogs, it is essential to evaluate its pharmacological properties, including cytotoxicity and efficacy, in relevant biological systems to assess its therapeutic potential.

Formula: C₂₅H₁₉BrCl₂N₂O₇

InChI: InChI=1S/C25H19BrCl2N2O7/c26-10-9-16-12-30(25(34)29-22(16)31)21-11-19(37-24(33)15-3-7-18(28)8-4-15)20(36-21)13-35-23(32)14-1-5-17(27)6-2-14/h1-10,12,19-21H,11,13H2,(H,29,31,34)/b10-9+/t19-,20+,21+/m0/s1

InChI key: InChIKey=ODZHXZBXXUFBMH-JQTKOYJDSA-N

SMILES: O=C1N([C@H]2C[C@H](OC(=O)C3=CC=C(Cl)C=C3)[C@@H](COC(=O)C4=CC=C(Cl)C=C4)O2)C=C(/C=C/Br)C(=O)N1

Synonyms:

• Uridine, 5-(2-bromoethenyl)-2′-deoxy-, 3′,5′-bis(4-chlorobenzoate), (E)-
• Uridine, 5-[(1E)-2-bromoethenyl]-2′-deoxy-, 3′,5′-bis(4-chlorobenzoate)

Brivudine Impurity 6

CAS: 87531-10-0

Formula: C₂₅H₁₉BrCl₂N₂O₇

Molecular weight: 610.24

Ref: ST-EA-CP-B132008