CAS 87532-77-2
:3-methoxy-3-phenylpiperidin-2-one
Description:
3-Methoxy-3-phenylpiperidin-2-one, identified by its CAS number 87532-77-2, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a methoxy group (-OCH3) and a phenyl group (-C6H5) at the 3-position. The presence of the methoxy group contributes to its potential solubility in organic solvents and may influence its reactivity and biological activity. The carbonyl group (ketone) at the 2-position is significant for its chemical properties, potentially participating in various reactions such as nucleophilic additions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its structural characteristics suggest potential interactions with biological targets, although specific biological activities would require empirical investigation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c1-15-12(8-5-9-13-11(12)14)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,13,14)
Synonyms:- 2-piperidinone, 3-methoxy-3-phenyl-
- 3-Methoxy-3-phenylpiperidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
