
CAS 87533-50-4
:N-(3,5-Diacetylphenyl)acetamide
Description:
N-(3,5-Diacetylphenyl)acetamide, with the CAS number 87533-50-4, is an organic compound characterized by its amide functional group and acetyl substituents. This compound features a phenyl ring substituted at the 3 and 5 positions with acetyl groups, which contribute to its chemical reactivity and potential applications. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic structure. The presence of the acetyl groups enhances its reactivity, making it useful in various chemical synthesis processes, including the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its stability under standard conditions allows for handling and storage in laboratory settings, although care should be taken to avoid exposure to strong oxidizing agents. Overall, N-(3,5-Diacetylphenyl)acetamide is a versatile compound with significant implications in organic synthesis and potential therapeutic applications.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-7(14)10-4-11(8(2)15)6-12(5-10)13-9(3)16/h4-6H,1-3H3,(H,13,16)
InChI key:InChIKey=YONMWXOYCWFJFH-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(C(C)=O)=CC(C(C)=O)=C1
Synonyms:- Acetamide, N-(3,5-diacetylphenyl)-
- N-(3,5-Diacetylphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.