CymitQuimica logo

CAS 87533-52-6

:

Ethanone, 1,1′-(5-methyl-1,3-phenylene)bis-

Description:
Ethanone, 1,1′-(5-methyl-1,3-phenylene)bis- is an organic compound characterized by its structure, which features a central ethanone group linked to a bis(5-methyl-1,3-phenylene) moiety. This compound belongs to the class of ketones, which are characterized by the presence of a carbonyl group (C=O) bonded to two carbon atoms. The presence of the 5-methyl-1,3-phenylene groups indicates that the compound has aromatic characteristics, contributing to its stability and potential reactivity. The methyl substituent on the phenylene ring can influence the compound's physical properties, such as solubility and boiling point. Generally, compounds like this may exhibit moderate to high melting and boiling points due to the presence of aromatic systems. Additionally, the compound may show interesting chemical reactivity, including potential for electrophilic substitution reactions typical of aromatic compounds. Its applications could span various fields, including materials science and organic synthesis, depending on its specific properties and reactivity.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-7-4-10(8(2)12)6-11(5-7)9(3)13/h4-6H,1-3H3
InChI key:InChIKey=MBRFZJXQMMOBGI-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(C(C)=O)=CC(C)=C1
Synonyms:
  • 1,1′-(5-Methyl-1,3-phenylene)diethanone
  • 1-(3-Acetyl-5-methylphenyl)ethan-1-one
  • Ethanone, 1,1′-(5-methyl-1,3-phenylene)bis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.