CAS 87533-55-9
:Ethanone, 1,1′-(4-nitro-1,3-phenylene)bis-
Description:
Ethanone, 1,1′-(4-nitro-1,3-phenylene)bis-, also known by its CAS number 87533-55-9, is an organic compound characterized by its structure, which features a central ethanone moiety linked to a 4-nitro-1,3-phenylene group. This compound typically exhibits properties associated with aromatic nitro compounds, including potential stability under standard conditions and solubility in organic solvents. The presence of the nitro group (-NO2) introduces electron-withdrawing characteristics, which can influence the compound's reactivity and polarity. As a result, it may participate in electrophilic aromatic substitution reactions. Additionally, the compound's molecular structure suggests potential applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with nitro compounds. Overall, the compound's unique structural features contribute to its chemical behavior and potential utility in various chemical applications.
Formula:C10H9NO4
InChI:InChI=1S/C10H9NO4/c1-6(12)8-3-4-10(11(14)15)9(5-8)7(2)13/h3-5H,1-2H3
InChI key:InChIKey=FDMJVWUNTYCWJB-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(N(=O)=O)C=CC(C(C)=O)=C1
Synonyms:- 1-(5-Acetyl-2-nitrophenyl)ethan-1-one
- 1-(3-Acetyl-4-nitrophenyl)ethanone
- Ethanone, 1,1′-(4-nitro-1,3-phenylene)bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
