CymitQuimica logo

CAS 875340-50-4

:

4-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine

Description:
4-Chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a chloro substituent at the 4-position and a phenyl group at the 6-position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro group can enhance its reactivity, making it a candidate for various chemical transformations. Additionally, the phenyl group can influence its electronic properties and interactions with biological targets. This compound is of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways. Its synthesis and characterization are important for understanding its properties and potential uses in pharmaceuticals or agrochemicals. As with many heterocycles, it may exhibit interesting pharmacological activities, warranting further investigation into its biological effects and mechanisms of action.
Formula:C12H8ClN3
InChI:InChI=1/C12H8ClN3/c13-12-11-10(14-7-15-12)6-9(16-11)8-4-2-1-3-5-8/h1-7,16H
SMILES:c1ccc(cc1)c1cc2c(c(Cl)ncn2)[nH]1
Synonyms:
  • 5H-pyrrolo[3,2-d]pyrimidine, 4-chloro-6-phenyl-
  • 4-Chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine
  • chloro-6-phenyl-
  • 5H-Pyrrolo[3,2-d]pyriMidine, 4-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.