CAS 87539-84-2
:3-phenyl-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-Phenyl-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine is a chemical compound characterized by its complex structure, which includes a phthalazine core fused with a triazole ring and a phenyl group. This compound features a pyrrolidine moiety, contributing to its potential biological activity. The presence of multiple heterocycles suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. Its molecular structure indicates potential for interactions with receptors or enzymes, making it a candidate for research in medicinal chemistry. The compound's CAS number, 87539-84-2, allows for easy identification in chemical databases. As with many heterocyclic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Further studies would be necessary to elucidate its specific properties, including its synthesis, mechanism of action, and potential applications in drug development or other fields.
Formula:C19H17N5
InChI:InChI=1/C19H17N5/c1-2-8-14(9-3-1)17-20-21-18-15-10-4-5-11-16(15)19(22-24(17)18)23-12-6-7-13-23/h1-5,8-11H,6-7,12-13H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Triazolo[3,4-a]phthalazine,3-phenyl-6-(1-pyrrolidinyl)-
CAS:Formula:C19H17N5Molecular weight:315.3718
