CAS 87539-90-0

N-methyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine

Description:

N-methyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a methyl group attached to a nitrogen atom in the triazole ring and a phenyl group, contributing to its aromatic properties. The presence of the amine functional group indicates potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. Its unique structure may impart specific biological activities, which could be explored in pharmacological studies. The compound's CAS number, 87539-90-0, allows for easy identification in chemical databases and literature. As with many heterocyclic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, N-methyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine represents a class of compounds that may exhibit diverse chemical and biological properties.

Formula: C₁₆H₁₃N₅

InChI: InChI=1/C16H13N5/c1-17-14-12-9-5-6-10-13(12)16-19-18-15(21(16)20-14)11-7-3-2-4-8-11/h2-10H,1H3,(H,17,20)

N-METHYL-3-PHENYL-1,2,4-TRIAZOLO[3,4-A]PHTHALAZIN-6-AMINE

CAS: 87539-90-0

Formula: C₁₆H₁₃N₅

Molecular weight: 275.3079

Ref: IN-DA004F02