CymitQuimica logo

CAS 87539-93-3

:

N-benzyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine

Description:
N-benzyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity. The presence of the benzyl and phenyl groups contributes to its lipophilicity, which may enhance its ability to interact with biological systems. It may also exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. The compound's structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Its CAS number, 87539-93-3, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, N-benzyl-3-phenyl[1,2,4]triazolo[3,4-a]phthalazin-6-amine represents a unique scaffold that could lead to the discovery of novel therapeutic agents.
Formula:C22H17N5
InChI:InChI=1/C22H17N5/c1-3-9-16(10-4-1)15-23-20-18-13-7-8-14-19(18)22-25-24-21(27(22)26-20)17-11-5-2-6-12-17/h1-14H,15H2,(H,23,26)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.