CymitQuimica logo

CAS 87539-98-8

:

3-phenyl-6-piperidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine

Description:
3-Phenyl-6-piperidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine, identified by its CAS number 87539-98-8, is a chemical compound that belongs to the class of triazolo-phthalazine derivatives. This compound features a complex structure characterized by a phthalazine core fused with a triazole ring and substituted with a phenyl group and a piperidine moiety. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. The compound's unique structure may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the triazole ring is known for its role in enhancing the bioactivity of compounds, potentially leading to applications in therapeutic areas such as anti-inflammatory or antimicrobial agents. Overall, the characteristics of this compound suggest it may have significant implications in pharmaceutical research, although specific biological activities would require further investigation.
Formula:C20H19N5
InChI:InChI=1/C20H19N5/c1-3-9-15(10-4-1)18-21-22-19-16-11-5-6-12-17(16)20(23-25(18)19)24-13-7-2-8-14-24/h1,3-6,9-12H,2,7-8,13-14H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.