CAS 87540-03-2
:3-(2-bromophenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(2-bromophenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-03-2, is a synthetic organic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a bromophenyl substituent and a pyrrolidine group, contributing to its potential biological activity. The presence of the triazole ring often indicates properties related to pharmacological activity, as triazoles are known for their role in various therapeutic agents. The bromine atom in the structure may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the pyrrolidine ring can impart conformational flexibility, which may be crucial for binding interactions. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new pharmaceuticals. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C19H16BrN5
InChI:InChI=1/C19H16BrN5/c20-16-10-4-3-9-15(16)18-22-21-17-13-7-1-2-8-14(13)19(23-25(17)18)24-11-5-6-12-24/h1-4,7-10H,5-6,11-12H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Triazolo[3,4-a]phthalazine,3-(2-bromophenyl)-6-(1-pyrrolidinyl)-
CAS:Formula:C19H16BrN5Molecular weight:394.2678
