CAS 87540-12-3
:3-(4-chloro-3-nitrophenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(4-chloro-3-nitrophenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine is a complex organic compound characterized by its unique structural features, which include a triazole ring fused to a phthalazine moiety. The presence of a pyrrolidine group contributes to its potential biological activity, while the 4-chloro-3-nitrophenyl substituent may influence its electronic properties and reactivity. This compound is likely to exhibit specific interactions with biological targets due to its diverse functional groups, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anticancer properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies, including pharmacological evaluations and toxicological assessments, would be necessary to fully understand its properties and potential applications.
Formula:C19H15ClN6O2
InChI:InChI=1/C19H15ClN6O2/c20-15-8-7-12(11-16(15)26(27)28)17-21-22-18-13-5-1-2-6-14(13)19(23-25(17)18)24-9-3-4-10-24/h1-2,5-8,11H,3-4,9-10H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(4-Chloro-3-nitrophenyl)-6-(pyrrolidin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine
CAS:Formula:C19H15ClN6O2Molecular weight:394.8144
