CAS 87540-16-7
:6-pyrrolidin-1-yl-3-(2,4,5-triethoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazine
Description:
6-Pyrrolidin-1-yl-3-(2,4,5-triethoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazine, with CAS number 87540-16-7, is a complex organic compound characterized by its unique structural features, including a triazolo-phthalazine core and a pyrrolidine moiety. This compound exhibits a range of chemical properties due to the presence of multiple functional groups, such as the triethoxyphenyl substituent, which can influence its solubility, reactivity, and potential biological activity. The triazole ring contributes to its stability and may participate in various chemical interactions, making it of interest in medicinal chemistry. The presence of the pyrrolidine ring can enhance its pharmacological properties, potentially affecting its interaction with biological targets. Overall, this compound's intricate structure suggests potential applications in drug development, particularly in areas requiring compounds with specific pharmacological profiles. Further studies would be necessary to elucidate its exact properties, including its reactivity, solubility, and biological activity.
Formula:C25H29N5O3
InChI:InChI=1/C25H29N5O3/c1-4-31-20-16-22(33-6-3)21(32-5-2)15-19(20)24-27-26-23-17-11-7-8-12-18(17)25(28-30(23)24)29-13-9-10-14-29/h7-8,11-12,15-16H,4-6,9-10,13-14H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(PYRROLIDIN-1-YL)-3-(2,4,5-TRIETHOXYPHENYL)-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C25H29N5O3Molecular weight:447.5295
