CymitQuimica logo

CAS 87540-17-8

:

3-(3,5-dibromo-2-ethoxyphenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine

Description:
3-(3,5-Dibromo-2-ethoxyphenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-17-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring fused to a phthalazine moiety. This compound features multiple functional groups, including bromine substituents and an ethoxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the pyrrolidine moiety suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. The dibromo substitution enhances its lipophilicity and may influence its solubility and stability in different solvents. Additionally, the compound's structural features may allow for interactions with specific receptors or enzymes, making it a candidate for further investigation in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules, particularly in the context of drug discovery and development.
Formula:C21H19Br2N5O
InChI:InChI=1/C21H19Br2N5O/c1-2-29-18-16(11-13(22)12-17(18)23)20-25-24-19-14-7-3-4-8-15(14)21(26-28(19)20)27-9-5-6-10-27/h3-4,7-8,11-12H,2,5-6,9-10H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.