CAS 87540-18-9
:3-(3-bromo-4,5-dimethoxyphenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(3-bromo-4,5-dimethoxyphenyl)-6-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-18-9, is a synthetic organic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a brominated aromatic ring and two methoxy groups, contributing to its potential biological activity and solubility properties. The presence of the pyrrolidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its unique structural features may impart specific pharmacological properties, potentially influencing its efficacy and safety profile in therapeutic applications. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. As with many synthetic compounds, understanding its reactivity, stability, and interaction with other molecules is crucial for its application in research or drug development.
Formula:C21H20BrN5O2
InChI:InChI=1/C21H20BrN5O2/c1-28-17-12-13(11-16(22)18(17)29-2)19-23-24-20-14-7-3-4-8-15(14)21(25-27(19)20)26-9-5-6-10-26/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-Bromo-4,5-dimethoxyphenyl)-6-(pyrrolidin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine
CAS:Formula:C21H20BrN5O2Molecular weight:454.3198
