CAS 87540-38-3
:N,N-bis(2-methoxyethyl)-3-(3-methylphenyl)[1,2,4]triazolo[3,4-a]phthalazin-6-amine
Description:
N,N-bis(2-methoxyethyl)-3-(3-methylphenyl)[1,2,4]triazolo[3,4-a]phthalazin-6-amine is a synthetic organic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features two methoxyethyl groups, which enhance its solubility and may influence its biological activity. The presence of the 3-methylphenyl group contributes to its aromatic character, potentially affecting its interactions with biological targets. The triazole and phthalazine components are known for their diverse pharmacological properties, including potential anti-inflammatory and anticancer activities. The compound's molecular structure suggests it may engage in hydrogen bonding and π-π stacking interactions, which are important for its reactivity and biological function. Additionally, the presence of nitrogen atoms in the triazole and phthalazine rings may impart unique electronic properties, making it a candidate for further research in medicinal chemistry. Overall, this compound exemplifies the complexity and potential utility of heterocyclic compounds in drug development.
Formula:C22H25N5O2
InChI:InChI=1/C22H25N5O2/c1-16-7-6-8-17(15-16)20-23-24-21-18-9-4-5-10-19(18)22(25-27(20)21)26(11-13-28-2)12-14-29-3/h4-10,15H,11-14H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N-BIS(2-METHOXYETHYL)-3-(3-METHYLPHENYL)-1,2,4-TRIAZOLO[3,4-A]PHTHALAZIN-6-AMINE
CAS:Formula:C22H25N5O2Molecular weight:391.4662
