CAS 87540-41-8
:3-(2-bromophenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(2-Bromophenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. The presence of the ethoxy group and the bromophenyl substituent contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The bromine atom can enhance the compound's lipophilicity and may also participate in various chemical reactions, such as nucleophilic substitutions. The triazole ring is known for its stability and ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Overall, the characteristics of this compound suggest potential applications in drug development, particularly in areas where triazole derivatives are known to exhibit therapeutic effects. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C17H13BrN4O
InChI:InChI=1/C17H13BrN4O/c1-2-23-17-12-8-4-3-7-11(12)15-19-20-16(22(15)21-17)13-9-5-6-10-14(13)18/h3-10H,2H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Bromophenyl)-6-ethoxy-[1,2,4]triazolo[3,4-a]phthalazine
CAS:Formula:C17H13BrN4OMolecular weight:369.2153
