CymitQuimica logo

CAS 87540-45-2

:

N-[4-(6-ethoxy[1,2,4]triazolo[3,4-a]phthalazin-3-yl)phenyl]acetamide

Description:
N-[4-(6-ethoxy[1,2,4]triazolo[3,4-a]phthalazin-3-yl)phenyl]acetamide, with the CAS number 87540-45-2, is a chemical compound that features a complex structure incorporating a phthalazine moiety and a triazole ring. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry. The presence of the ethoxy group enhances its solubility and may influence its pharmacokinetic properties. The acetamide functional group suggests potential for hydrogen bonding, which can affect its binding affinity to target proteins. Additionally, the compound's structural features may contribute to its stability and reactivity under different conditions. As with many compounds in this class, its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods, including spectroscopy and chromatography. Overall, this compound represents a class of molecules that could have applications in drug development and therapeutic research.
Formula:C19H17N5O2
InChI:InChI=1/C19H17N5O2/c1-3-26-19-16-7-5-4-6-15(16)18-22-21-17(24(18)23-19)13-8-10-14(11-9-13)20-12(2)25/h4-11H,3H2,1-2H3,(H,20,25)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.