CAS 87540-47-4
:3-(4-chloro-3-nitrophenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(4-chloro-3-nitrophenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine is a complex organic compound characterized by its unique triazole and phthalazine structures. This substance features a triazole ring fused to a phthalazine moiety, which contributes to its potential biological activity. The presence of a 4-chloro-3-nitrophenyl group enhances its chemical reactivity and may influence its pharmacological properties. The ethoxy group attached to the triazole ring can affect solubility and lipophilicity, making it relevant for medicinal chemistry applications. This compound may exhibit various biological activities, including antimicrobial or anticancer properties, due to its structural features. Its synthesis and characterization typically involve advanced organic chemistry techniques, and it may be of interest in research fields such as drug development and materials science. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated and nitro-substituted aromatic compounds.
Formula:C17H12ClN5O3
InChI:InChI=1/C17H12ClN5O3/c1-2-26-17-12-6-4-3-5-11(12)16-20-19-15(22(16)21-17)10-7-8-13(18)14(9-10)23(24)25/h3-9H,2H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Triazolo[3,4-a]phthalazine,3-(4-chloro-3-nitrophenyl)-6-ethoxy-
CAS:Formula:C17H12ClN5O3Molecular weight:369.7619
