CAS 87540-48-5
:6-ethoxy-3-[3-methoxy-4-(pentyloxy)phenyl][1,2,4]triazolo[3,4-a]phthalazine
Description:
6-Ethoxy-3-[3-methoxy-4-(pentyloxy)phenyl][1,2,4]triazolo[3,4-a]phthalazine is a complex organic compound characterized by its unique structural features, which include a triazolo ring fused to a phthalazine moiety. This compound contains multiple functional groups, such as an ethoxy group and a methoxy-pentyloxy-substituted phenyl group, contributing to its potential solubility and reactivity. The presence of the triazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the triazole's known biological activity. The compound's molecular structure may influence its physical properties, such as melting point, boiling point, and solubility in various solvents. Additionally, the presence of multiple substituents can affect its electronic properties and reactivity, making it a candidate for further study in organic synthesis and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of potential therapeutic applications.
Formula:C23H26N4O3
InChI:InChI=1/C23H26N4O3/c1-4-6-9-14-30-19-13-12-16(15-20(19)28-3)21-24-25-22-17-10-7-8-11-18(17)23(29-5-2)26-27(21)22/h7-8,10-13,15H,4-6,9,14H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-ETHOXY-3-(3-METHOXY-4-(PENTYLOXY)PHENYL)-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C23H26N4O3Molecular weight:406.4775
