CAS 87540-49-6
:3-(3,4-dimethoxyphenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(3,4-Dimethoxyphenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-49-6, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a phthalazine core fused with a triazole ring, which contributes to its potential biological activity. The presence of methoxy and ethoxy substituents enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly for their anti-inflammatory, antimicrobial, or anticancer activities. The molecular structure suggests that it may interact with various biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability, reactivity, and solubility in different solvents are important characteristics that would be evaluated in laboratory settings. Overall, 3-(3,4-dimethoxyphenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine represents a class of compounds that could offer valuable insights into new therapeutic agents.
Formula:C19H18N4O3
InChI:InChI=1/C19H18N4O3/c1-4-26-19-14-8-6-5-7-13(14)18-21-20-17(23(18)22-19)12-9-10-15(24-2)16(11-12)25-3/h5-11H,4H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Triazolo[3,4-a]phthalazine,3-(3,4-dimethoxyphenyl)-6-ethoxy-
CAS:Formula:C19H18N4O3Molecular weight:350.3712
