CymitQuimica logo

CAS 87540-50-9

:

3-chloro-4-(7-ethoxy[1,2,4]triazolo[3,4-a]phthalazin-3-yl)-N,N-dimethylaniline

Description:
3-Chloro-4-(7-ethoxy[1,2,4]triazolo[3,4-a]phthalazin-3-yl)-N,N-dimethylaniline is a complex organic compound characterized by its unique structural features, including a chloro substituent, a triazole ring, and a dimethylaniline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its heterocyclic components. The presence of the triazole ring may contribute to its pharmacological properties, as triazoles are often found in various medicinal compounds. The chloro group can influence the compound's reactivity and stability, while the ethoxy group may enhance solubility and bioavailability. Additionally, the dimethylaniline part of the molecule can affect its electronic properties and interactions with biological targets. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and drug development, where its potential applications could be explored further.
Formula:C19H18ClN5O
InChI:InChI=1/C19H18ClN5O/c1-4-26-17-7-5-6-13-15(17)11-21-25-18(13)22-23-19(25)14-9-8-12(24(2)3)10-16(14)20/h5-11H,4H2,1-3H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.