CAS 87540-51-0
:6-ethoxy-3-(2,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazine
Description:
6-Ethoxy-3-(2,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-51-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring fused to a phthalazine moiety. This compound features an ethoxy group and a trimethoxyphenyl substituent, contributing to its potential biological activity and solubility properties. The presence of multiple methoxy groups typically enhances lipophilicity, which may influence its pharmacokinetic behavior. The triazole ring is known for its role in various biological applications, including as a scaffold in drug design due to its ability to form hydrogen bonds and interact with biological targets. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature reviews. Overall, this compound represents a unique structure that may have implications in pharmaceutical research and development.
Formula:C20H20N4O4
InChI:InChI=1/C20H20N4O4/c1-5-28-20-13-9-7-6-8-12(13)18-21-22-19(24(18)23-20)14-10-16(26-3)17(27-4)11-15(14)25-2/h6-11H,5H2,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-ETHOXY-3-(2,4,5-TRIMETHOXYPHENYL)-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C20H20N4O4Molecular weight:380.3972
