CAS 87540-53-2
:3-(3,5-dibromo-2-ethoxyphenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine
Description:
3-(3,5-Dibromo-2-ethoxyphenyl)-6-ethoxy[1,2,4]triazolo[3,4-a]phthalazine, with the CAS number 87540-53-2, is a synthetic organic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features multiple bromine substituents and ethoxy groups, contributing to its unique chemical properties. The presence of bromine atoms typically enhances the compound's reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The ethoxy groups can enhance solubility in organic solvents, which is beneficial for various applications, including drug formulation. Additionally, the triazole ring is known for its role in pharmacology, often exhibiting antifungal and antibacterial properties. The compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, detailed studies on its specific biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C19H16Br2N4O2
InChI:InChI=1/C19H16Br2N4O2/c1-3-26-16-14(9-11(20)10-15(16)21)18-23-22-17-12-7-5-6-8-13(12)19(27-4-2)24-25(17)18/h5-10H,3-4H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3,5-Dibromo-2-ethoxyphenyl)-6-ethoxy-[1,2,4]triazolo[3,4-a]phthalazine
CAS:Formula:C19H16Br2N4O2Molecular weight:492.1639
