CAS 87540-64-5
:6-(ethylsulfanyl)-3-phenyl[1,2,4]triazolo[3,4-a]phthalazine
Description:
6-(Ethylsulfanyl)-3-phenyl[1,2,4]triazolo[3,4-a]phthalazine, identified by the CAS number 87540-64-5, is a chemical compound that belongs to the class of triazolo-phthalazines. This substance features a triazole ring fused to a phthalazine structure, which contributes to its unique chemical properties. The presence of the ethylsulfanyl group enhances its potential for various chemical interactions, making it of interest in medicinal chemistry and drug development. The compound is characterized by its aromatic nature, which can influence its solubility and reactivity. Additionally, the phenyl group attached to the triazole ring may impart specific biological activities, potentially making it a candidate for pharmacological applications. Its synthesis and characterization typically involve standard organic chemistry techniques, and its stability and reactivity can be influenced by the substituents present. Overall, this compound represents a fascinating area of study within heterocyclic chemistry, with implications for developing new therapeutic agents.
Formula:C17H14N4S
InChI:InChI=1/C17H14N4S/c1-2-22-17-14-11-7-6-10-13(14)16-19-18-15(21(16)20-17)12-8-4-3-5-9-12/h3-11H,2H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Triazolo[3,4-a]phthalazine,6-(ethylthio)-3-phenyl-
CAS:Formula:C17H14N4SMolecular weight:306.3849
