CAS 87540-65-6
:3-phenyl[1,2,4]triazolo[3,4-a]phthalazine-6(5H)-thione
Description:
3-Phenyl[1,2,4]triazolo[3,4-a]phthalazine-6(5H)-thione is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a phenyl group attached to the triazole, contributing to its aromatic properties. The presence of a thione functional group (–C=S) indicates that it may exhibit unique reactivity and potential biological activity, as thiones can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The compound's structure suggests it may possess interesting electronic properties due to the conjugation between the aromatic systems and the heteroatoms in the triazole and thiazole rings. Additionally, compounds of this type have been studied for their potential pharmacological applications, including antimicrobial and anticancer activities. Its CAS number, 87540-65-6, allows for easy identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound exemplifies the rich chemistry associated with heterocyclic compounds and their potential utility in various applications.
Formula:C15H10N4S
InChI:InChI=1/C15H10N4S/c20-15-12-9-5-4-8-11(12)14-17-16-13(19(14)18-15)10-6-2-1-3-7-10/h1-9H,(H,18,20)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
