CAS 87540-68-9
:6-phenyl-N-prop-2-en-1-yl[1,2,4]triazolo[3,4-a]phthalazin-3-amine
Description:
6-Phenyl-N-prop-2-en-1-yl[1,2,4]triazolo[3,4-a]phthalazin-3-amine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a phenyl group and a prop-2-en-1-yl substituent, contributing to its unique reactivity and potential biological activity. The presence of the triazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the triazole's known role in enhancing the bioactivity of compounds. The amine functional group may also impart basic properties, influencing solubility and interaction with biological targets. The compound's molecular structure indicates potential for diverse interactions, making it a candidate for further research in areas such as drug design and synthesis. Its CAS number, 87540-68-9, allows for easy identification in chemical databases, facilitating access to relevant literature and safety data. Overall, this compound exemplifies the intricate relationship between molecular structure and potential applications in various fields of chemistry and pharmacology.
Formula:C18H15N5
InChI:InChI=1/C18H15N5/c1-2-12-19-18-21-20-17-15-11-7-6-10-14(15)16(22-23(17)18)13-8-4-3-5-9-13/h2-11H,1,12H2,(H,19,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-PHENYL-3-(2-ALLYLAMINO)-1,2,4-TRIAZOLO[3,4-A]PHTHALAZINE
CAS:Formula:C18H15N5Molecular weight:301.3452
