CymitQuimica logo

CAS 87540-69-0

:

8-chloro-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine

Description:
8-Chloro-6-phenyl[1,2,4]triazolo[3,4-a]phthalazine is a heterocyclic compound characterized by its complex triazole and phthalazine structure. This compound features a chlorine atom at the 8-position and a phenyl group at the 6-position of the triazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of the triazole ring imparts potential biological activity, making it of interest in medicinal chemistry, particularly for its potential use in pharmaceuticals. The compound may also exhibit interesting electronic properties due to its conjugated system, which can influence its reactivity and interactions with other molecules. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C15H9ClN4
InChI:InChI=1/C15H9ClN4/c16-11-6-7-12-13(8-11)14(10-4-2-1-3-5-10)19-20-9-17-18-15(12)20/h1-9H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.