CymitQuimica logo

CAS 87540-71-4

:

6-phenyl[1,2,4]triazolo[3,4-a]phthalazine-3(2H)-thione

Description:
6-Phenyl[1,2,4]triazolo[3,4-a]phthalazine-3(2H)-thione is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a phenyl group at the 6-position of the triazole, contributing to its aromatic properties. The presence of a thione functional group (–S) at the 3-position enhances its reactivity and potential biological activity. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the thione group. Such compounds often display a range of biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the triazole and phthalazine rings. Overall, 6-phenyl[1,2,4]triazolo[3,4-a]phthalazine-3(2H)-thione represents a class of compounds with potential applications in pharmaceuticals and materials science.
Formula:C15H10N4S
InChI:InChI=1/C15H10N4S/c20-15-17-16-14-12-9-5-4-8-11(12)13(18-19(14)15)10-6-2-1-3-7-10/h1-9H,(H,17,20)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.