CymitQuimica logo

CAS 87540-76-9

:

6-phenyl-3-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine

Description:
6-Phenyl-3-pyrrolidin-1-yl[1,2,4]triazolo[3,4-a]phthalazine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a phthalazine moiety. This compound features a phenyl group and a pyrrolidine substituent, contributing to its potential biological activity. The presence of the triazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, as triazoles are known for their diverse biological properties, including antifungal and anticancer activities. The compound's molecular structure may influence its solubility, stability, and interaction with biological targets. Additionally, the specific arrangement of functional groups can affect its pharmacokinetics and pharmacodynamics. While detailed studies on this compound may be limited, its unique structural features indicate potential for further research in drug discovery and development. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C19H17N5
InChI:InChI=1/C19H17N5/c1-2-8-14(9-3-1)17-15-10-4-5-11-16(15)18-20-21-19(24(18)22-17)23-12-6-7-13-23/h1-5,8-11H,6-7,12-13H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.